CAS 3244-65-3
:Ac-Ser-Gly-OH
Description:
The chemical substance known as Ac-Ser-Gly-OH, with the CAS number 3244-65-3, is a peptide that consists of the amino acids serine (Ser) and glycine (Gly) with an acetyl (Ac) group attached to the serine residue. This compound is characterized by its relatively small size and specific sequence, which influences its biochemical properties and potential biological activity. The acetylation of serine enhances the stability and solubility of the peptide, making it more suitable for various applications in biochemistry and molecular biology. Ac-Ser-Gly-OH may play a role in peptide synthesis, drug development, and as a model compound for studying peptide interactions and modifications. Its structure allows for potential interactions with enzymes and receptors, which can be of interest in therapeutic research. Additionally, the presence of hydroxyl groups in serine contributes to its hydrophilicity, affecting its solubility in aqueous environments. Overall, Ac-Ser-Gly-OH serves as a valuable compound in the study of peptide chemistry and its applications in biological systems.
Formula:C7H12N2O5
InChI:InChI=1/C7H12N2O5/c1-4(11)9-5(3-10)7(14)8-2-6(12)13/h5,10H,2-3H2,1H3,(H,8,14)(H,9,11)(H,12,13)/t5-/m0/s1
SMILES:CC(=N[C@@H](CO)C(=NCC(=O)O)O)O
Synonyms:- N-Acetylserylglycine
- Ac-Ser-gly
- Glycine, N-(N-acetyl-L-seryl)-
- N-acetyl-L-serylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Acetyl-L-serylglycine
CAS:Controlled ProductFormula:C7H12N2O5Color and Shape:NeatMolecular weight:204.181Ac-Ser-Gly-OH
CAS:Ac-Ser-Gly-OH is a tripeptide, meaning it has three amino acids. It is a hydrophobic molecule that contains the sequence of amino acid residues Ac-Ser-Gly. The residue of Ac-Ser-Gly-OH is an acetylated serine and glycolic acid. This tripeptide can be modified through techniques such as incubation or tryptic digestion. The postsynthetic modification technique of biosynthesis is used to create Ac-Ser-Gly-OH from its precursor, polyisoprenoid, which can also be sequenced to determine its nature with the help of techniques such as mass spectrometry.
Formula:C7H12N2O5Purity:Min. 95%Molecular weight:204.18 g/mol

