CAS 32443-70-2
:N-[(E)-[(2E,4S,5R)-2-(benzoylhydrazono)-4,5,6-trihydroxy-hexylidene]amino]benzamide
Description:
N-[(E)-[(2E,4S,5R)-2-(benzoylhydrazono)-4,5,6-trihydroxy-hexylidene]amino]benzamide, with the CAS number 32443-70-2, is a complex organic compound characterized by its unique structural features. It contains a hydrazone functional group, which is formed from the reaction of a hydrazine with a carbonyl compound, contributing to its reactivity and potential biological activity. The presence of multiple hydroxyl groups indicates that it may exhibit hydrogen bonding capabilities, enhancing its solubility in polar solvents and potentially influencing its interaction with biological targets. The stereochemistry, particularly the (E) and (S) configurations, suggests that the compound may have specific spatial arrangements that could affect its pharmacological properties. Additionally, the benzamide moiety may contribute to its ability to interact with various biological systems, making it of interest in medicinal chemistry. Overall, this compound's intricate structure and functional groups suggest potential applications in pharmaceuticals or as a biochemical probe, although further studies would be necessary to elucidate its specific properties and activities.
Formula:C20H22N4O5
InChI:InChI=1/C20H22N4O5/c25-13-18(27)17(26)11-16(22-24-20(29)15-9-5-2-6-10-15)12-21-23-19(28)14-7-3-1-4-8-14/h1-10,12,17-18,25-27H,11,13H2,(H,23,28)(H,24,29)/b21-12+,22-16+/t17-,18+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Deoxy-D-erythro-hexos-2-ulose-bis-benzoylhydrazone
CAS:Controlled ProductFormula:C20H22N4O5Color and Shape:NeatMolecular weight:398.413-Deoxy-D-erythro-hexos-2-ulose-bis-benzoylhydrazone-13C6
CAS:Controlled ProductFormula:C6C14H22N4O5Color and Shape:NeatMolecular weight:404.3683-Deoxy-D-glucosone-bis(benzoylhydrazone)
CAS:<p>3-Deoxy-D-glucosone-bis(benzoylhydrazone) is a synthetic compound that has been used in the synthesis of saccharides and oligosaccharides. This reagent can be used for the methylation of glycosyl groups, as well as the modification of carbohydrate chains to produce complex carbohydrates. 3-Deoxy-D-glucosone-bis(benzoylhydrazone) is a white powder with a molecular weight of 239. It is soluble in methanol, ethanol, acetone, and chloroform. The CAS number for this compound is 32443-70-2.</p>Formula:C20H22N4O5Purity:Min. 95%Molecular weight:398.41 g/mol


