CAS 32444-34-1
:2-ethyl-3-methylbutan-1-ol
Description:
2-Ethyl-3-methylbutan-1-ol, with the CAS number 32444-34-1, is a branched-chain alcohol characterized by its structure, which includes a butanol backbone with ethyl and methyl substituents. This compound is typically a colorless liquid at room temperature and possesses a distinctive odor reminiscent of alcohols. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic alkyl groups. The presence of the hydroxyl (-OH) functional group imparts typical alcohol properties, such as the ability to participate in hydrogen bonding, which influences its boiling point and reactivity. 2-Ethyl-3-methylbutan-1-ol can be used as a solvent, in the synthesis of other organic compounds, and may have applications in the fragrance and flavor industry. Its physical and chemical properties, such as boiling point, melting point, and density, are influenced by its molecular structure and the presence of functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H16O
InChI:InChI=1/C7H16O/c1-4-7(5-8)6(2)3/h6-8H,4-5H2,1-3H3
SMILES:CCC(CO)C(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Ethyl-3-methylbutan-1-ol
CAS:2-Ethyl-3-methylbutan-1-ol is a chemical that can be activated at the 2-, 3-, or 4-position by a stepwise process. The amines are used in the synthesis of other compounds, such as pharmaceuticals and polymers. The selectivity for the alkylation reaction is high, with yields greater than 95%. The ethyl group can be removed from 2-ethyl-3-methylbutan-1-ol by using an alcohol catalyst. This chemical has been shown to have high yields when synthesized with a transfer hydrogenation reaction. It also has a byproduct that can be removed with hydrogen gas in the presence of palladium on carbon.Formula:C7H16OPurity:Min. 95%Molecular weight:116.2 g/mol
