CAS 32444-35-2

3-(Bromomethyl)-2-methylpentane

Description:

3-(Bromomethyl)-2-methylpentane is an organic compound characterized by its branched alkane structure, featuring a bromomethyl group attached to the third carbon of a 2-methylpentane backbone. This compound is classified as a haloalkane due to the presence of a bromine atom, which significantly influences its reactivity and physical properties. It is typically a colorless to pale yellow liquid with a distinct odor, and its boiling point and melting point are influenced by the molecular weight and branching of the carbon chain. The presence of the bromine atom makes it a good candidate for nucleophilic substitution reactions, allowing for further functionalization. Additionally, it is important to handle this compound with care due to the potential hazards associated with brominated compounds, including toxicity and environmental concerns. Its applications may include use in organic synthesis, as an intermediate in the production of pharmaceuticals, or in the development of specialty chemicals. Proper storage and disposal methods should be followed to mitigate any risks associated with its use.

Formula: C₇H₁₅Br

InChI: InChI=1S/C7H15Br/c1-4-7(5-8)6(2)3/h6-7H,4-5H2,1-3H3

InChI key: InChIKey=KHNFYUURJZUZIA-UHFFFAOYSA-N

SMILES: C(C(C)C)(CBr)CC

Synonyms:

• 3-(Bromomethyl)-2-methylpentane
• Pentane, 3-(bromomethyl)-2-methyl-