CAS 32445-90-2

β,β-Dimethyl-4-(trifluoromethyl)benzeneethanol

Description:

β,β-Dimethyl-4-(trifluoromethyl)benzeneethanol, with the CAS number 32445-90-2, is an organic compound characterized by its unique structure that includes a benzene ring substituted with both a trifluoromethyl group and a hydroxyl group, along with two methyl groups. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits moderate solubility in organic solvents. The presence of the trifluoromethyl group imparts significant polarity and can influence the compound's reactivity and interactions with other molecules. The hydroxyl group contributes to its potential as an alcohol, allowing for hydrogen bonding, which can affect its boiling point and solubility in water. Additionally, the steric hindrance introduced by the dimethyl groups may impact its chemical behavior, making it of interest in various chemical synthesis and pharmaceutical applications. Overall, β,β-Dimethyl-4-(trifluoromethyl)benzeneethanol is a compound of interest in both industrial and research settings due to its distinctive properties.

Formula: C₁₁H₁₃F₃O

InChI: InChI=1S/C11H13F3O/c1-10(2,7-15)8-3-5-9(6-4-8)11(12,13)14/h3-6,15H,7H2,1-2H3

InChI key: InChIKey=NQBFNCRRADOJHM-UHFFFAOYSA-N

SMILES: C(CO)(C)(C)C1=CC=C(C(F)(F)F)C=C1

Synonyms:

• β,β-Dimethyl-4-(trifluoromethyl)benzeneethanol
• Phenethyl alcohol, β,β-dimethyl-p-(trifluoromethyl)-
• 2-(p-Trifluoromethylphenyl)-2-methyl-propan-1-ol
• Benzeneethanol, β,β-dimethyl-4-(trifluoromethyl)-
• 2-Methyl-2-[4-(trifluoromethyl)phenyl]propan-1-ol