CAS 32448-00-3
:tetrahydro-3bH-[1,3]dioxolo[4,5]furo[3,2-d][1,3]dioxin-7-ylmethyl acetate (non-preferred name)
Description:
Tetrahydro-3bH-[1,3]dioxolo[4,5]furo[3,2-d][1,3]dioxin-7-ylmethyl acetate, identified by its CAS number 32448-00-3, is a chemical compound characterized by its complex bicyclic structure that incorporates dioxole and dioxin moieties. This compound typically exhibits properties associated with its functional groups, including potential reactivity due to the presence of ester and ether linkages. It may be soluble in organic solvents, reflecting its hydrophobic characteristics, while its molecular structure suggests potential applications in organic synthesis or as an intermediate in the production of more complex molecules. The presence of multiple oxygen atoms in its structure may confer unique chemical reactivity, including the ability to participate in various chemical reactions such as nucleophilic substitutions or cycloadditions. Additionally, the compound's specific stereochemistry can influence its biological activity and interactions, making it of interest in medicinal chemistry and materials science. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C10H14O7
InChI:InChI=1/C10H14O7/c1-5(11)12-2-6-7-8(14-3-13-6)9-10(17-7)16-4-15-9/h6-10H,2-4H2,1H3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-O-Acetyl-1,2:3,5-di-O-methylidene-a-D-glucofuranose
CAS:6-O-Acetyl-1,2:3,5-di-O-methylidene-a-D-glucofuranose is a methylated saccharide that is a member of the polysaccharides. The compound has been modified using click chemistry to produce a fluorescent derivative. 6-O-Acetyl-1,2:3,5-di-O-methylidene-a-D-glucofuranose is also used for glycosylation and can be synthesized to provide high purity carbohydrates or sugars. It has an CAS number of 3244800 and may be used as a fluorinated complex carbohydrate.Formula:C12H18O7Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:274.27 g/mol
