CAS 32449-41-5

6-Bromo-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol

Description:

6-Bromo-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a bromine atom at the 6-position and a methyl group at the 5-position of the triazole ring, contributing to its chemical reactivity and potential biological activity. The presence of the hydroxyl group at the 7-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of anti-inflammatory and antimicrobial agents. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and methyl substituents, making it a valuable subject for further research in organic synthesis and pharmacology.

Formula: C₆H₅BrN₄O

InChI: InChI=1S/C6H5BrN4O/c1-3-4(7)5(12)11-6(10-3)8-2-9-11/h2,12H,1H3

InChI key: InChIKey=IUWBPTDPBVIOOI-UHFFFAOYSA-N

SMILES: OC=1N2C(N=C(C)C1Br)=NC=N2

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidin-7-ol, 6-bromo-5-methyl-
• 6-Bromo-7-hydroxy-5-methyl-1,3,4-triazaindolizine
• 6-Bromo-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol
• 6-Bromo-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol
• s-Triazolo[1,5-a]pyrimidin-7-ol, 6-bromo-5-methyl-