CAS 3245-41-8

4-(2-Bromoethoxy)-1,2-dichlorobenzene

Description:

4-(2-Bromoethoxy)-1,2-dichlorobenzene, with the CAS number 3245-41-8, is an organic compound characterized by its aromatic structure and the presence of multiple halogen substituents. This compound features a dichlorobenzene core, where two chlorine atoms are attached to the benzene ring, enhancing its reactivity and potential applications in various chemical processes. The presence of a bromoethoxy group introduces an ether functionality, which can influence its solubility and reactivity. Typically, compounds like this exhibit moderate to low solubility in water but may dissolve in organic solvents. The halogen atoms contribute to the compound's potential as an intermediate in organic synthesis, particularly in the production of pharmaceuticals or agrochemicals. Additionally, the presence of bromine and chlorine can impart unique properties, such as increased stability against oxidation and the ability to participate in nucleophilic substitution reactions. Safety considerations are essential when handling this compound due to the toxicity associated with halogenated organic compounds.

Formula: C₈H₇BrCl₂O

InChI: InChI=1S/C8H7BrCl2O/c9-3-4-12-6-1-2-7(10)8(11)5-6/h1-2,5H,3-4H2

InChI key: InChIKey=SQMJIYQANBYVEL-UHFFFAOYSA-N

SMILES: O(CCBr)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• β-(3,4-Dichlorophenoxy)ethyl bromide
• Benzene, 4-(2-bromoethoxy)-1,2-dichloro-
• 4-(2-Bromoethoxy)-1,2-dichlorobenzene
• 2-bromoethyl 3,4-dichlorophenyl ether
• Phenetole, β-bromo-3,4-dichloro-
• 2-(3,4-Dichlorophenoxy)ethyl bromide