CAS 32453-36-4

Quercetin 3-O-neohesperidoside

Description:

Quercetin 3-O-neohesperidoside, also known as quercetin neohesperidoside, is a flavonoid glycoside derived from quercetin, a well-known antioxidant. This compound features a quercetin aglycone linked to a neohesperidose sugar moiety, which enhances its solubility and bioavailability. It is typically found in various plants, particularly in citrus fruits and certain herbs, contributing to their health benefits. Quercetin 3-O-neohesperidoside exhibits several biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in nutritional and pharmaceutical research. Its structure allows it to interact with various biological pathways, potentially modulating oxidative stress and inflammation. Additionally, it may have a role in cardiovascular health by improving endothelial function. The compound is generally considered safe for consumption, but its effects can vary based on dosage and individual health conditions. As research continues, the full spectrum of its therapeutic potential and mechanisms of action is being explored, highlighting its significance in functional foods and dietary supplements.

Formula: C₂₇H₃₀O₁₆

InChI: InChI=1S/C27H30O16/c1-8-17(33)20(36)22(38)26(39-8)43-25-21(37)18(34)15(7-28)41-27(25)42-24-19(35)16-13(32)5-10(29)6-14(16)40-23(24)9-2-3-11(30)12(31)4-9/h2-6,8,15,17-18,20-22,25-34,36-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22+,25+,26-,27-/m0/s1

InChI key: InChIKey=FYBMGZSDYDNBFX-GXPPAHCZSA-N

SMILES: O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](O)[C@H](O)[C@@H](CO)O4

Synonyms:

• Quercetin 3-neohesperidoside
• 3-[[2-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one
• Flavone, 3,3′,4′,5,7-pentahydroxy-, 3-[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside]
• Q 7
• 4H-1-Benzopyran-4-one, 3-[[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-

3-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxy-oxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one

CAS: 32453-36-4

Formula: C₂₇H₃₀O₁₆

Purity: 98%

Molecular weight: 610.5175

Ref: IN-DA01G9NE

Quercetin 3-O-neohesperidin

CAS: 32453-36-4

Formula: C₂₇H₃₀O₁₆

Purity: 95%~99%

Molecular weight: 610.521

Ref: BP-BP4762

Quercetin 3-O-neohesperidoside

CAS: 32453-36-4

Quercetin 3-O-neohesperidoside is a natural product exhibiting μM-level inhibitory activity against AChE.

Formula: C₂₇H₃₀O₁₆

Purity: 99.97%

Color and Shape: Solid

Molecular weight: 610.52

Ref: TM-TN1044

Quercetin 3-o-neohesperidoside

CAS: 32453-36-4

Quercetin 3-o-neohesperidoside is a naturally occurring flavonoid glycoside, derived from various plant sources including certain fruits, vegetables, and leaves. This compound is recognized for its robust antioxidant properties, operating at the cellular level by scavenging free radicals and reducing oxidative stress. It functions through the stabilization of reactive oxygen species and the chelation of metal ions, thereby protecting biomolecules such as DNA, lipids, and proteins from oxidative damage.

Formula: C₂₇H₃₀O₁₆

Purity: Min. 95%

Molecular weight: 610.5 g/mol

Ref: 3D-HBA45336