CAS 324546-09-0

2-Thiophenecarboxamide, N-[4-[(2-pyrimidinylamino)sulfonyl]phenyl]-

Description:

2-Thiophenecarboxamide, N-[4-[(2-pyrimidinylamino)sulfonyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a thiophene ring, a carboxamide functional group, and a sulfonamide moiety linked to a pyrimidine and phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the thiophene ring may impart unique electronic properties, while the sulfonamide and carboxamide functionalities can enhance solubility and reactivity. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry as inhibitors or modulators of biological targets. The molecular interactions of this compound may involve hydrogen bonding and π-π stacking due to its aromatic components. Overall, the specific characteristics, including solubility, stability, and reactivity, would depend on the precise molecular environment and conditions under which the compound is studied.

Formula: C₁₅H₁₂N₄O₃S₂

InChI: InChI=1S/C15H12N4O3S2/c20-14(13-3-1-10-23-13)18-11-4-6-12(7-5-11)24(21,22)19-15-16-8-2-9-17-15/h1-10H,(H,18,20)(H,16,17,19)

InChI key: JFKBCMLLRYCZIC-UHFFFAOYSA-N

SMILES: C1=CN=C(N=C1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CS3