CAS 324560-63-6

4-[(isopropylamino)methyl]aniline

Description:

4-[(Isopropylamino)methyl]aniline, identified by its CAS number 324560-63-6, is an organic compound characterized by the presence of an aniline group substituted with an isopropylamino group. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical reactions, including as a building block in organic synthesis. The isopropylamino moiety enhances its solubility in organic solvents and may influence its biological activity. The compound is likely to exhibit moderate to high polarity due to the presence of both amine and aromatic functionalities. Safety data sheets should be consulted for handling and storage guidelines, as compounds with amine groups can be hazardous. Overall, 4-[(isopropylamino)methyl]aniline is of interest in fields such as pharmaceuticals, agrochemicals, and materials science, where it may serve as an intermediate or functional agent in the development of more complex molecules.

Formula: C₁₀H₁₆N₂

InChI: InChI=1/C10H16N2/c1-8(2)12-7-9-3-5-10(11)6-4-9/h3-6,8,12H,7,11H2,1-2H3

SMILES: CC(C)NCc1ccc(cc1)N

Synonyms:

• Benzenemethanamine, 4-amino-N-(1-methylethyl)-

N-Isopropyl-4-aminobenzylamine

CAS: 324560-63-6

Formula: C₁₀H₁₆N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 164.2474

Ref: IN-DA003T4N

4-((Isopropylamino)methyl)aniline

CAS: 324560-63-6

Formula: C₁₀H₁₆N₂

Purity: 95%

Molecular weight: 164.252

Ref: 10-F446310