CAS 324568-52-7

Ethyl 2-amino-4-methyl-5-[[(2-methylphenyl)amino]carbonyl]-3-thiophenecarboxylate

Description:

Ethyl 2-amino-4-methyl-5-[[(2-methylphenyl)amino]carbonyl]-3-thiophenecarboxylate, with the CAS number 324568-52-7, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a thiophene ring. This compound features a substituted thiophene, which contributes to its potential biological activity and chemical reactivity. The presence of the amino and carbonyl groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The aromatic 2-methylphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. Such compounds often exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Additionally, the presence of multiple functional groups indicates that it may serve as a versatile building block for further chemical synthesis or modification. Overall, this compound's unique structure and functional groups suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₆H₁₈N₂O₃S

InChI: InChI=1S/C16H18N2O3S/c1-4-21-16(20)12-10(3)13(22-14(12)17)15(19)18-11-8-6-5-7-9(11)2/h5-8H,4,17H2,1-3H3,(H,18,19)

InChI key: InChIKey=PGVIRPTYJZFNOW-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(C)=C(C(NC2=C(C)C=CC=C2)=O)SC1N

Synonyms:

• Ethyl 2-amino-4-methyl-5-[[(2-methylphenyl)amino]carbonyl]-3-thiophenecarboxylate
• 3-Thiophenecarboxylic acid, 2-amino-4-methyl-5-[[(2-methylphenyl)amino]carbonyl]-, ethyl ester