CAS 324580-52-1

Butanamide, N-(4-acetylphenyl)-

Description:

Butanamide, N-(4-acetylphenyl)-, also known by its CAS number 324580-52-1, is an organic compound characterized by the presence of a butanamide functional group attached to a 4-acetylphenyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amide bond, which can engage in hydrogen bonding. The acetyl group contributes to its aromatic character and may influence its reactivity and interaction with biological systems. The molecular structure suggests potential applications in pharmaceuticals or as a chemical intermediate, given the presence of both the amide and aromatic functionalities. Additionally, the compound may exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, Butanamide, N-(4-acetylphenyl)- is a compound of interest in organic synthesis and medicinal chemistry.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1S/C12H15NO2/c1-3-4-12(15)13-11-7-5-10(6-8-11)9(2)14/h5-8H,3-4H2,1-2H3,(H,13,15)

InChI key: KJUCBOHGQYYIQU-UHFFFAOYSA-N

SMILES: CCCC(=O)NC1=CC=C(C=C1)C(=O)C