CAS 32467-88-2: N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
Description:N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine, with the CAS number 32467-88-2, is a synthetic peptide that exhibits characteristics typical of amino acid derivatives. This compound features a complex structure comprising a pentanoic acid backbone, an amino acid side chain, and specific stereochemistry, which contributes to its biological activity. The presence of both L- and D-amino acids in its structure suggests potential applications in pharmaceuticals, particularly in the development of peptide-based drugs. The amino and carboxyl functional groups indicate that it can participate in various chemical reactions, including peptide bond formation and interactions with biological targets. Additionally, the cysteine residue may facilitate the formation of disulfide bonds, enhancing the stability and functionality of the peptide. Overall, this compound's unique structural features and stereochemistry make it a subject of interest in medicinal chemistry and biochemistry, particularly in the context of drug design and therapeutic applications.
Formula:C14H25N3O6S
InChI:InChI=1/C14H25N3O6S/c1-7(2)11(14(22)23)17-12(19)9(6-24)16-10(18)5-3-4-8(15)13(20)21/h7-9,11,24H,3-6,15H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)(H,22,23)/t8-,9-,11+/m0/s1
- Synonyms:
- d-(L-a-Aminoadipyl)-L-cysteinyl-D-valine
- D-valine, N-[(5S)-5-amino-5-carboxy-1-oxopentyl]-L-cysteinyl-
- N-[N-(L-5-Amino-5-carboxyvaleryl)-L-cysteinyl]-D-valine
![N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine](https://static.cymitquimica.com/cas-image/298840-n-5s-5-amino-5-carboxypentanoyl-l-cysteinyl-d-valine.png)
