CAS 324769-01-9

4-Piperidinone, 3-ethyl-, hydrochloride (1:1)

Description:

4-Piperidinone, 3-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone structure, which features a six-membered ring containing nitrogen and a carbonyl group. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which is indicative of its hydrochloride salt form. The presence of the ethyl group at the 3-position of the piperidinone ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it exhibits enhanced stability and solubility compared to its free base form. This compound may be of interest in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. Its specific applications and effects would depend on further studies, including its interaction with biological systems and potential therapeutic uses. Safety data should be consulted to ensure proper handling and usage in laboratory settings.

Formula: C₇H₁₃NO.ClH

InChI: InChI=1S/C7H13NO.ClH/c1-2-6-5-8-4-3-7(6)9;/h6,8H,2-5H2,1H3;1H

InChI key: InChIKey=UZZGBBJZUQNFKD-UHFFFAOYSA-N

SMILES: C(C)C1C(=O)CCNC1.Cl