CAS 3248-05-3: 4,7-Dimethyl-1,10-phenanthroline
Description:4,7-Dimethyl-1,10-phenanthroline, with the CAS number 3248-05-3, is an organic compound belonging to the phenanthroline family, characterized by its two methyl groups located at the 4 and 7 positions of the phenanthroline structure. This compound is typically a solid at room temperature and exhibits a deep color, often used as a chelating agent for metal ions due to its ability to form stable complexes. It has a planar structure, which contributes to its effective coordination with transition metals, making it valuable in various applications, including analytical chemistry and materials science. The presence of nitrogen atoms in its aromatic rings enhances its electron-donating properties, allowing it to participate in redox reactions. Additionally, 4,7-Dimethyl-1,10-phenanthroline is known for its fluorescence properties, which can be exploited in sensing applications. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled.
Formula:C14H12N2
InChI:InChI=1S/C14H12N2/c1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13/h3-8H,1-2H3
InChI key:InChIKey=JIVLDFFWTQYGSR-UHFFFAOYSA-N
SMILES:N=1C=CC(=C2C=CC3=C(N=CC=C3C)C12)C
- Synonyms:
- 1,10-Phenanthroline, 4,7-dimethyl-
- 1,8-Dimethyl-4,5-diazaphenanthrene
- 4,7-Dimethy-1,10-Phenathroline
- 4,7-Dimethyl-o-phenanthroline
- Nsc 4281
- Timtec-Bb Sbb008716
- 4,7-Dimethyl-1,10-phenanthroline
