CAS 32486-23-0
:5-[2-(fluorooxy)-2-oxoethyl]furan-2(5H)-one
Description:
5-[2-(Fluorooxy)-2-oxoethyl]furan-2(5H)-one, identified by its CAS number 32486-23-0, is a chemical compound that features a furan ring, which is a five-membered aromatic heterocycle containing oxygen. This compound is characterized by the presence of a fluorooxy group and a keto group, contributing to its reactivity and potential applications in organic synthesis. The furan moiety is known for its ability to participate in various chemical reactions, including electrophilic substitutions and cycloadditions. The presence of the fluorooxy substituent may enhance the compound's polarity and influence its solubility in different solvents, which is crucial for its behavior in chemical reactions. Additionally, the compound's structure suggests potential biological activity, making it of interest in medicinal chemistry. Overall, 5-[2-(fluorooxy)-2-oxoethyl]furan-2(5H)-one exemplifies a versatile structure that could be explored for various synthetic and pharmaceutical applications.
Formula:C6H5FO4
InChI:InChI=1/C6H5FO4/c7-11-6(9)3-4-1-2-5(8)10-4/h1-2,4H,3H2
InChI key:JWTRAEIUKUKVDW-UHFFFAOYSA-N
SMILES:C1=CC(=O)OC1CC(=O)OF
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery