CAS 32488-48-5
:diphenyl(~13~C)methanone
Description:
Diphenyl(13C)methanone, also known as phenyl phenyl ketone, is an aromatic ketone characterized by the presence of two phenyl groups attached to a carbonyl group (C=O). The incorporation of the stable isotope carbon-13 (13C) in its structure allows for specific applications in isotopic labeling and tracing studies in organic chemistry. This compound typically exhibits a white to pale yellow crystalline appearance and is soluble in organic solvents such as ethanol and acetone, but is generally insoluble in water due to its hydrophobic nature. Diphenyl(13C)methanone is often utilized in research and industrial applications, including as a reagent in organic synthesis and as a standard in NMR spectroscopy due to its distinct spectral characteristics. Its stability and relatively low reactivity make it a valuable compound in various chemical processes. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C1213CH10O
InChI:InChI=1/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i13+1
Synonyms:- Diphenyl(< sup> 13< /sup> C)methanone
- methanone-< sup> 13< /sup> C, diphenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzophenone-13C1(carbonyl-13C)
CAS:Formula:C6H513COC6H5Purity:99 atom % 13CColor and Shape:White SolidMolecular weight:694.04828Benzophenone-13C
CAS:<p>Applications Benzophenone-13C was useful for studying the behaviour of cumulene molecules when absorbed in faujasite zeolite pores.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Shibata, S., et al.: Bull. Chem. Soc. Japan, 93, 663 (2020)<br></p>Formula:CC12H10OColor and Shape:NeatMolecular weight:183.21
