CAS 3249-33-0
:ethyl 4-oxohexanoate
Description:
Ethyl 4-oxohexanoate, with the CAS number 3249-33-0, is an organic compound that belongs to the class of esters. It is characterized by its structure, which includes a six-carbon chain with a ketone functional group at the fourth carbon and an ethyl ester group. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, making it potentially useful in flavoring and fragrance applications. Ethyl 4-oxohexanoate is soluble in organic solvents and exhibits moderate solubility in water, which is common for many esters. Its chemical properties include reactivity with nucleophiles, making it a candidate for various synthetic reactions, including condensation and acylation. Additionally, it may undergo hydrolysis in the presence of water and acids or bases, leading to the formation of the corresponding acid and alcohol. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, ethyl 4-oxohexanoate is a versatile compound with applications in organic synthesis and the flavor industry.
Formula:C8H14O3
InChI:InChI=1/C8H14O3/c1-3-7(9)5-6-8(10)11-4-2/h3-6H2,1-2H3
SMILES:CCC(=O)CCC(=O)OCC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ethyl 4-oxohexanoate
CAS:Ethyl 4-oxohexanoate is an organic compound that is a dicarboxylic acid. It is used in the synthesis of esters and lactones. Ethyl 4-oxohexanoate undergoes decarboxylation to produce diethyl succinate. This reaction can be accelerated by heating ethyl 4-oxohexanoate with a catalyst such as calcium oxide, giving evolution of carbon dioxide gas. Hydrolysis of ethyl 4-oxohexanoate produces ethyl acetate as well as ethanol, which are both volatile liquids at room temperature.
Formula:C8H14O3Purity:Min. 95%Molecular weight:158.19 g/molRef: 3D-DAA24933
Discontinued product
