CAS 32493-03-1

5-Methyl-1-propyl-1H-pyrazole

Description:

5-Methyl-1-propyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. This compound features a methyl group and a propyl group attached to the pyrazole ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the alkyl substituents influences its solubility, making it more soluble in organic solvents than in water. 5-Methyl-1-propyl-1H-pyrazole may exhibit biological activity, which can be of interest in various fields, including pharmaceuticals and agrochemicals. Its reactivity can be attributed to the nitrogen atoms in the ring, which can participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. As with many pyrazole derivatives, it may also serve as a building block for synthesizing more complex molecules in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₁₂N₂

InChI: InChI=1S/C7H12N2/c1-3-6-9-7(2)4-5-8-9/h4-5H,3,6H2,1-2H3

InChI key: InChIKey=QSXMOLQKFYLQAJ-UHFFFAOYSA-N

SMILES: C(CC)N1C(C)=CC=N1

Synonyms:

• 1-Propyl-5-methylpyrazole
• 1H-Pyrazole, 5-methyl-1-propyl-
• 5-Methyl-1-propyl-1H-pyrazole
• 5-Methyl-1-propyl-1H-pyrazole