CAS 3251-07-8
:Methyl 4-aminobutanoate
Description:
Methyl 4-aminobutanoate, also known as methyl 4-aminobutyrate, is an organic compound characterized by its amine and ester functional groups. It is a derivative of gamma-aminobutyric acid (GABA) and features a methyl ester group attached to the carboxylic acid portion of the molecule. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Methyl 4-aminobutanoate is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. It is often used in the synthesis of pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The presence of the amino group contributes to its basicity and potential reactivity in nucleophilic substitution reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C5H11NO2
InChI:InChI=1S/C5H11NO2/c1-8-5(7)3-2-4-6/h2-4,6H2,1H3
InChI key:InChIKey=KVQGGLZHHFGHPU-UHFFFAOYSA-N
SMILES:C(CCCN)(OC)=O
Synonyms:- Butanoic acid, 4-amino-, methyl ester
- Methyl 4-aminobutyrate
- Methyl 4-aminobutanoate
- Methyl γ-aminobutyrate
- Butyric acid, 4-amino-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
