CAS 32513-92-1: Dibenzoyllysine
Description:Dibenzoyllysine is an organic compound characterized by its structure, which features two benzoyl groups attached to the amino acid lysine. This compound is typically classified as an amide due to the presence of the amine functional group from lysine, combined with the carbonyl groups from the benzoyl moieties. Dibenzoyllysine is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and other chemical products. It exhibits properties typical of amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the benzoyl groups can enhance its stability and influence its reactivity, making it a useful intermediate in various chemical reactions. Additionally, dibenzoyllysine may exhibit specific biological activities, although detailed studies on its pharmacological properties are limited. Overall, its unique structure and functional groups contribute to its significance in both synthetic and medicinal chemistry.
Formula:C20H22N2O4
InChI:InChI=1/C20H22N2O4/c23-18(15-9-3-1-4-10-15)21-14-8-7-13-17(20(25)26)22-19(24)16-11-5-2-6-12-16/h1-6,9-12,17H,7-8,13-14H2,(H,21,23)(H,22,24)(H,25,26)
- Synonyms:
- lysine, N~2~,N~6~-dibenzoyl-
- N~2~,N~6~-Dibenzoyllysine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | α,ε-dibenzoyl-DL-lysine REF: IN-DA003NRQCAS: 32513-92-1 | 99% | 35.00 €~522.00 € | Tue 12 Aug 25 |
![]() | α,ε-Dibenzoyl-DL-lysine REF: 54-OR1028267CAS: 32513-92-1 | 99% | 32.00 €~2,049.00 € | Wed 13 Aug 25 |
![]() | ±,µ-Dibenzoyl-DL-lysine REF: 3D-HBA51392CAS: 32513-92-1 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA003NRQ
1g | 75.00 € | ||
5g | 164.00 € | ||
10g | 226.00 € | ||
25g | 522.00 € | ||
100mg | 35.00 € | ||
250mg | 50.00 € |

Ref: 54-OR1028267
1g | 55.00 € | ||
5g | 138.00 € | ||
25g | 580.00 € | ||
100g | 2,049.00 € | ||
250mg | 32.00 € |

±,µ-Dibenzoyl-DL-lysine
Ref: 3D-HBA51392
10g | Discontinued | Request information | |
50g | Discontinued | Request information |