
CAS 325144-72-7
:3-[[6-O-[(3R)-4-Carboxy-3-hydroxy-3-methyl-1-oxobutyl]-β-D-glucopyranosyl]oxy]-2-methyl-4H-pyran-4-one
Description:
The chemical substance known as "3-[[6-O-[(3R)-4-Carboxy-3-hydroxy-3-methyl-1-oxobutyl]-β-D-glucopyranosyl]oxy]-2-methyl-4H-pyran-4-one," with the CAS number 325144-72-7, is a complex organic compound characterized by its glycosylated structure. It features a pyranone core, which is a six-membered ring containing both oxygen and carbon atoms, contributing to its potential biological activity. The presence of a β-D-glucopyranosyl moiety indicates that it is a glycoside, suggesting that it may exhibit properties related to carbohydrate chemistry, such as solubility in water and potential interactions with biological systems. The carboxylic acid and hydroxyl functional groups present in the molecule enhance its polarity and reactivity, which may influence its pharmacological properties. This compound may be of interest in medicinal chemistry and biochemistry due to its structural complexity and potential applications in drug development or as a biochemical probe. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C18H24O12
InChI:InChI=1S/C18H24O12/c1-8-16(9(19)3-4-27-8)30-17-15(25)14(24)13(23)10(29-17)7-28-12(22)6-18(2,26)5-11(20)21/h3-4,10,13-15,17,23-26H,5-7H2,1-2H3,(H,20,21)/t10-,13-,14+,15-,17+,18-/m1/s1
InChI key:InChIKey=WCVUIHQUPRXYKT-XUGHYYTGSA-N
SMILES:O([C@@H]1O[C@H](COC(C[C@](CC(O)=O)(C)O)=O)[C@@H](O)[C@H](O)[C@H]1O)C=2C(=O)C=COC2C
Synonyms:- Tachiogroside B
- 4H-Pyran-4-one, 3-[[6-O-[(3R)-4-carboxy-3-hydroxy-3-methyl-1-oxobutyl]-β-D-glucopyranosyl]oxy]-2-methyl-
- 3-[[6-O-[(3R)-4-Carboxy-3-hydroxy-3-methyl-1-oxobutyl]-β-D-glucopyranosyl]oxy]-2-methyl-4H-pyran-4-one
- Licoagroside B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Licoagroside B
CAS:Licoagroside B is a useful organic compound for research related to life sciences and the catalog number is T130375.Formula:C18H24O12Color and Shape:SolidMolecular weight:432.378
