CAS 3254-17-9
:[(3aR,6R,7S,7aS)-6,7-diacetoxy-2-ethoxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate
Description:
The chemical substance with the name "[(3aR,6R,7S,7aS)-6,7-diacetoxy-2-ethoxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate" and CAS number 3254-17-9 is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as acetoxy and ethoxy moieties. This compound features a tetrahydro-dioxolo-pyran framework, indicating it possesses a fused ring system that contributes to its stereochemistry and potential biological activity. The presence of acetoxy groups suggests it may exhibit reactivity typical of esters, while the ethoxy group can influence its solubility and interaction with other substances. The stereochemical descriptors (3aR, 6R, 7S, 7aS) indicate specific spatial arrangements of atoms, which can significantly affect the compound's properties, including its pharmacological profile if applicable. Overall, this substance may be of interest in fields such as medicinal chemistry or natural product synthesis, where complex organic molecules are often explored for their potential therapeutic applications.
Formula:C16H24O10
InChI:InChI=1/C16H24O10/c1-6-21-16(5)25-14-13(23-10(4)19)12(22-9(3)18)11(7-20-8(2)17)24-15(14)26-16/h11-15H,6-7H2,1-5H3/t11?,12-,13+,14+,15-,16?/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3,4,6-Tri-O-acetyl-a-D-glucopyranose 1,2-(ethyl orthoacetate)
CAS:3,4,6-Tri-O-acetyl-a-D-glucopyranose 1,2-(ethyl orthoacetate) is a custom synthesis that can be used as a fluorination agent or methylating agent. This compound has been modified by the click modification reaction to attach oligosaccharides and saccharides to proteins and polysaccharides. 3,4,6-Tri-O-acetyl-a-D-glucopyranose 1,2-(ethyl orthoacetate) is a high purity synthetic carbohydrate with a purity of 99.5%.Formula:C16H24O10Purity:Min. 95%Molecular weight:376.35 g/mol

