CAS 3254-85-1

6-Carboxyisoxanthopterin

Description:

6-Carboxyisoxanthopterin is a chemical compound that belongs to the class of pteridines, which are bicyclic compounds containing a pyrimidine and a pyrazine ring. This substance is characterized by the presence of a carboxylic acid functional group at the 6-position of the isoxanthopterin structure, which contributes to its solubility and reactivity. It is typically found in biological systems and is involved in various biochemical processes, including those related to folate metabolism. The compound exhibits UV absorbance properties, making it useful in spectrophotometric applications. Its molecular structure allows for potential interactions with enzymes and other biomolecules, which may influence its biological activity. Additionally, 6-Carboxyisoxanthopterin can serve as a precursor or intermediate in the synthesis of other pteridine derivatives. As with many pteridines, it may also play a role in cellular processes such as electron transport and redox reactions. Overall, its unique structural features and biological relevance make it an interesting subject of study in biochemistry and pharmacology.

Formula: C₇H₅N₅O₄

InChI: InChI=1S/C7H5N5O4/c8-7-11-3-1(4(13)12-7)9-2(6(15)16)5(14)10-3/h(H,15,16)(H4,8,10,11,12,13,14)

InChI key: InChIKey=WFICTSPBINOLJT-UHFFFAOYSA-N

SMILES: O=C1C2=C(NC(=O)C(C(O)=O)=N2)NC(N)=N1

Synonyms:

• 6-Pteridinecarboxylic acid, 2-amino-1,4,7,8-tetrahydro-4,7-dioxo-
• 6-Carboxyisoxanthopterin
• 6-Pteridinecarboxylic acid, 2-amino-4,7-dihydroxy-
• 2-Amino-3,4,7,8-tetrahydro-4,7-dioxo-6-pteridinecarboxylic acid
• 6-Pteridinecarboxylic acid, 2-amino-3,4,7,8-tetrahydro-4,7-dioxo-