
CAS 325457-64-5
:4-[(1-Methyl-4-piperidinyl)oxy]-3-(trifluoromethyl)benzenamine
Description:
4-[(1-Methyl-4-piperidinyl)oxy]-3-(trifluoromethyl)benzenamine, identified by its CAS number 325457-64-5, is a chemical compound characterized by its complex structure that includes a trifluoromethyl group and a piperidine moiety. This compound typically exhibits properties associated with both aromatic amines and ether functionalities, which can influence its reactivity and solubility. The presence of the trifluoromethyl group often enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical research. The piperidine ring contributes to its basicity and potential interactions with biological targets. Additionally, this compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, its unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C13H17F3N2O
InChI:InChI=1S/C13H17F3N2O/c1-18-6-4-10(5-7-18)19-12-3-2-9(17)8-11(12)13(14,15)16/h2-3,8,10H,4-7,17H2,1H3
InChI key:InChIKey=FYCJYWMLKZJUNJ-UHFFFAOYSA-N
SMILES:O(C1=C(C(F)(F)F)C=C(N)C=C1)C2CCN(C)CC2
Synonyms:- [4-(1-Methylpiperidin-4-yloxy)-3-trifluoromethylphenyl]amine
- 4-(1-Methylpiperidin-4-yloxy)-3-trifluoromethylaniline
- 4-[(1-Methyl-4-piperidinyl)oxy]-3-(trifluoromethyl)benzenamine
- Benzenamine, 4-[(1-methyl-4-piperidinyl)oxy]-3-(trifluoromethyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery