CymitQuimica logo

CAS 325459-90-3

:

1-bromo-3-(heptadecafluorooctyl)benzene

Description:
1-Bromo-3-(heptadecafluorooctyl)benzene is a fluorinated organic compound characterized by the presence of a bromine atom and a long perfluorinated alkyl chain attached to a benzene ring. The heptadecafluorooctyl group, consisting of a chain of 17 carbon atoms fully substituted with fluorine atoms, imparts unique properties such as hydrophobicity and lipophobicity, making the compound useful in various applications, including surfactants and coatings. The bromine substituent can enhance reactivity, allowing for further chemical modifications. This compound is likely to exhibit low volatility and high thermal stability due to the strong carbon-fluorine bonds. Additionally, the presence of the fluorinated alkyl chain may contribute to its potential environmental persistence and bioaccumulation concerns. Safety data sheets would typically indicate handling precautions due to the potential toxicity associated with brominated and fluorinated compounds. Overall, 1-bromo-3-(heptadecafluorooctyl)benzene represents a class of compounds that combine aromatic chemistry with fluorinated functionalities, leading to distinctive physical and chemical properties.
Formula:C14H4BrF17
InChI:InChI=1/C14H4BrF17/c15-6-3-1-2-5(4-6)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)32/h1-4H
SMILES:c1cc(cc(c1)Br)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Found 0 products.