CAS 325486-37-1

1-benzyl-3-({[tert-butyl(dimethyl)silyl]oxy}methyl)piperidin-4-one

Description:

1-benzyl-3-({[tert-butyl(dimethyl)silyl]oxy}methyl)piperidin-4-one is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with a benzyl group and a tert-butyl(dimethyl)silyl ether. This compound typically exhibits properties associated with both piperidine derivatives and silyl ethers, such as moderate polarity and potential solubility in organic solvents. The presence of the silyl group may enhance its stability and reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The compound's structure suggests it may participate in nucleophilic reactions due to the presence of the piperidinone moiety, which can act as a nucleophile. Additionally, the bulky tert-butyl group may influence steric hindrance, affecting its reactivity and interactions with other molecules. Overall, this compound's unique characteristics make it a valuable intermediate in the development of pharmaceuticals or other chemical products.

Formula: C₁₉H₃₁NO₂Si

InChI: InChI=1/C19H31NO2Si/c1-19(2,3)23(4,5)22-15-17-14-20(12-11-18(17)21)13-16-9-7-6-8-10-16/h6-10,17H,11-15H2,1-5H3

SMILES: CC(C)(C)[Si](C)(C)OCC1CN(CCC1=O)Cc1ccccc1

4-Piperidinone,3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-(phenylmethyl)-

CAS: 325486-37-1

Formula: C₁₉H₃₁NO₂Si

Purity: 98%

Color and Shape: Liquid

Molecular weight: 333.5404

Ref: IN-DA007FAN

1-Benzyl-3-({[(tert-butyl)dimethylsilyl]oxy}methyl)piperidin-4-one

CAS: 325486-37-1

1-Benzyl-3-({[(tert-butyl)dimethylsilyl]oxy}methyl)piperidin-4-one

Purity: 95%

Molecular weight: 333.54g/mol

Ref: 54-OR6091

3-[[[(1,1-DIMETHYLETHYL)DIMETHYLSILYL]OXY]METHYL]-1-(PHENYLMETHYL)-4-PIPERIDINONE

CAS: 325486-37-1

Formula: C₁₉H₃₁NO₂Si

Purity: 95%

Molecular weight: 333.547

Ref: 10-F470103