CAS 325486-43-9
:2-Bromo-3,5-difluorophenol
Description:
2-Bromo-3,5-difluorophenol is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) and halogen substituents on the aromatic ring. Specifically, it features a bromine atom at the second position and two fluorine atoms at the third and fifth positions of the phenol ring. This compound is typically a solid at room temperature and may exhibit a white to off-white appearance. It is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the halogen substituents, which can participate in various chemical reactions, including nucleophilic substitutions. The presence of both bromine and fluorine can influence the compound's physical properties, such as solubility and boiling point, as well as its biological activity. Additionally, 2-Bromo-3,5-difluorophenol may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. As with many halogenated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact.
Formula:C6H3BrF2O
InChI:InChI=1/C6H3BrF2O/c7-6-4(9)1-3(8)2-5(6)10/h1-2,10H
SMILES:c1c(cc(c(c1F)Br)O)F
Synonyms:- Bromodifluorophenol1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-3,5-difluorophenol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3BrF2OPurity:98%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:208.992-Bromo-3,5-difluorophenol
CAS:Formula:C6H3BrF2OPurity:98%Color and Shape:SolidMolecular weight:208.98822-Bromo-3,5-difluorophenol
CAS:2-Bromo-3,5-difluorophenolFormula:C6H3BrF2OPurity:96%Color and Shape: colourless low melting solidMolecular weight:208.99g/mol2-Bromo-3,5-difluorophenol
CAS:Formula:C6H3BrF2OPurity:98%Color and Shape:Solid, Low Melting SolidMolecular weight:208.99



