CAS 32551-66-9

4-(2-aminoethyl)-2-(hydroxymethyl)phenol

Description:

4-(2-aminoethyl)-2-(hydroxymethyl)phenol, also known by its CAS number 32551-66-9, is an organic compound characterized by its phenolic structure, which includes a hydroxymethyl group and an aminoethyl side chain. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of both hydroxyl and amino functional groups, which can engage in hydrogen bonding. The amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its hydroxymethyl group can also serve as a reactive site for further functionalization. This compound is often studied for its potential applications in pharmaceuticals, biochemistry, and materials science, particularly in the development of biomolecules or as a building block in organic synthesis. Additionally, its structural features may contribute to its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₁₃NO₂

InChI: InChI=1/C9H13NO2/c10-4-3-7-1-2-9(12)8(5-7)6-11/h1-2,5,11-12H,3-4,6,10H2

InChI key: BKLPFXUDXVJWNO-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1CCN)CO)O