CAS 32556-70-0
:(R)-1-Octyn-3-ol
Description:
(R)-1-Octyn-3-ol is an organic compound characterized by its alkyne functional group and an alcohol group. It features a linear carbon chain consisting of eight carbon atoms, with a triple bond between the first and second carbon atoms, and a hydroxyl (-OH) group attached to the third carbon. This structure imparts unique properties, including its potential as a chiral building block in organic synthesis. The presence of the alkyne group contributes to its reactivity, allowing for various chemical transformations, while the alcohol group provides hydrogen bonding capabilities, influencing its solubility and boiling point. (R)-1-Octyn-3-ol is typically a colorless liquid at room temperature and may have a distinct odor. Its chirality can affect its interactions in biological systems, making it of interest in pharmaceuticals and agrochemicals. Additionally, it may be used in the synthesis of more complex molecules, highlighting its utility in organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H14O
InChI:InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3/t8-/m0/s1
SMILES:CCCCC[C@H](C#C)O
Synonyms:- (3R)-oct-1-yn-3-ol
- (R)-(+)-1-Octyn-3-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(R)-(+)-1-Octyn-3-ol, 98+%
CAS:<p>(R)-(+)-1-Octyn-3-ol is used as an intermediate for the synthesis of prostaglandins, modified eicosanoids structured with fatty acids attached to a 5 membered ring. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label in</p>Formula:C8H14OPurity:98+%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:126.20



