
CAS 32557-55-4
:2-Benzoyl-N-methylbenzamide
Description:
2-Benzoyl-N-methylbenzamide, with the CAS number 32557-55-4, is an organic compound characterized by its structural features, which include a benzoyl group and a N-methylbenzamide moiety. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and organic synthesis. It exhibits properties such as moderate solubility in organic solvents, which is common for aromatic compounds, and may show some degree of stability under standard conditions. The presence of both carbonyl and amide functional groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit biological activity, making it of interest for further research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H13NO2
InChI:InChI=1S/C15H13NO2/c1-16-15(18)13-10-6-5-9-12(13)14(17)11-7-3-2-4-8-11/h2-10H,1H3,(H,16,18)
InChI key:InChIKey=PVIBFBFCLHOUNR-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(NC)=O)C=CC=C1)C2=CC=CC=C2
Synonyms:- 2-Benzoyl-N-methylbenzamide
- Benzamide, o-benzoyl-N-methyl-
- Benzamide, 2-benzoyl-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nefopam Impurity 4
CAS:Formula:C15H13NO2Color and Shape:White To Off-White SolidMolecular weight:239.27
