CAS 32563-24-9

L-erythro-4-fluoroglutamic acid

Description:

L-erythro-4-fluoroglutamic acid is a synthetic amino acid derivative of glutamic acid, characterized by the presence of a fluorine atom at the fourth carbon position of the glutamic acid backbone. This modification can influence its biochemical properties and interactions. The compound is typically a white to off-white crystalline solid, soluble in water, and exhibits a polar nature due to the presence of the carboxylic acid groups. It is often studied for its potential role as a neurotransmitter or as a modulator in various biochemical pathways, particularly in the context of neuropharmacology. The fluorine substitution can enhance the stability and bioavailability of the compound, making it of interest in medicinal chemistry. Additionally, L-erythro-4-fluoroglutamic acid may exhibit unique pharmacological effects compared to its non-fluorinated counterparts, which can be leveraged in research and therapeutic applications. As with many amino acid derivatives, it is important to handle this compound with care, following appropriate safety protocols in laboratory settings.

Formula: C₅H₈FNO₄

InChI: InChI=1/C5H8FNO4/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)/t2-,3-/m0/s1

InChI key: JPSHPWJJSVEEAX-GBXIJSLDSA-N

SMILES: C([C@@H](C(=O)O)F)[C@@H](C(=O)O)N

Synonyms:

• (4S)-4-fluoro-L-glutamic acid