CAS 32565-17-6

ethyl 7-chloro-3-methyl-1-benzofuran-2-carboxylate

Description:

Ethyl 7-chloro-3-methyl-1-benzofuran-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzofuran moiety, a chloro substituent, and an ethyl ester functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of the chloro group may enhance its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. The ethyl ester group suggests that it may undergo hydrolysis under acidic or basic conditions, leading to the corresponding carboxylic acid. Additionally, the compound may exhibit biological activity, which is common among benzofuran derivatives, making it of interest in medicinal chemistry. Its molecular structure can influence its physical properties, such as melting point, boiling point, and solubility, which are essential for applications in pharmaceuticals and agrochemicals. Overall, ethyl 7-chloro-3-methyl-1-benzofuran-2-carboxylate represents a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₁₂H₁₁ClO₃

InChI: InChI=1/C12H11ClO3/c1-3-15-12(14)10-7(2)8-5-4-6-9(13)11(8)16-10/h4-6H,3H2,1-2H3

InChI key: PYNDYZIICZTLMZ-UHFFFAOYSA-N

SMILES: CCOC(=O)c1c(C)c2cccc(c2o1)Cl

Synonyms:

• 7-Chloro-3-methyl-benzofuran-2-carboxylic acid ethyl ester