CAS 32565-18-7

7-Chloro-3-methyl-2-benzofurancarboxylic acid

Description:

7-Chloro-3-methyl-2-benzofurancarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and a carboxylic acid functional group. This compound features a chlorine atom and a methyl group at specific positions on the benzofuran ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water can vary. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may form salts or esters. Additionally, the chlorine substituent can influence the compound's electronic properties and reactivity, making it of interest in medicinal chemistry and material science. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity. Overall, 7-Chloro-3-methyl-2-benzofurancarboxylic acid is a compound of interest for further research in various chemical applications.

Formula: C₁₀H₇ClO₃

InChI: InChI=1S/C10H7ClO3/c1-5-6-3-2-4-7(11)9(6)14-8(5)10(12)13/h2-4H,1H3,(H,12,13)

InChI key: InChIKey=GIWYZUBCAKLCAJ-UHFFFAOYSA-N

SMILES: ClC1=C2C(C(C)=C(C(O)=O)O2)=CC=C1

Synonyms:

• 2-Benzofurancarboxylic acid, 7-chloro-3-methyl-
• 7-Chloro-3-methyl-2-benzofurancarboxylic acid
• 7-Chloro-3-methyl-benzofuran-2-carboxylic acid
• 7-Chloro-3-methyl-1-benzofuran-2-carboxylic acid