CAS 325702-00-9

1-(2,4-Dinitrophenyl)-3-piperidinecarboxylic acid

Description:

1-(2,4-Dinitrophenyl)-3-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a dinitrophenyl group. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The presence of the dinitrophenyl moiety contributes to its reactivity, particularly in electrophilic aromatic substitution reactions. The carboxylic acid functional group imparts acidic properties, allowing for potential interactions in biological systems. Additionally, the compound may exhibit various biological activities, making it of interest in pharmacological research. Its molecular weight, solubility, and stability can vary based on environmental conditions and the presence of solvents. Safety considerations are important when handling this compound, as dinitrophenyl derivatives can be hazardous due to their potential toxicity and explosive nature under certain conditions. Proper laboratory protocols should be followed to ensure safe handling and disposal.

Formula: C₁₂H₁₃N₃O₆

InChI: InChI=1S/C12H13N3O6/c16-12(17)8-2-1-5-13(7-8)10-4-3-9(14(18)19)6-11(10)15(20)21/h3-4,6,8H,1-2,5,7H2,(H,16,17)

InChI key: InChIKey=WGMPZJMJSBSASH-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=CC(N(=O)=O)=C1)N2CC(C(O)=O)CCC2

Synonyms:

• 3-Piperidinecarboxylic acid, 1-(2,4-dinitrophenyl)-
• 1-(2,4-Dinitrophenyl)-3-piperidinecarboxylic acid