CAS 325722-28-9

1,1,7,7-Tetramethyljulolidine

Description:

1,1,7,7-Tetramethyljulolidine is an organic compound characterized by its unique structure, which includes a julolidine backbone with four methyl groups attached to the nitrogen and carbon atoms. This compound is typically a colorless to pale yellow liquid and is known for its high stability and low volatility. It exhibits a strong fluorescence, making it useful in various applications, including as a fluorescent probe in chemical and biological research. The presence of multiple methyl groups contributes to its steric hindrance, which can influence its reactivity and solubility in different solvents. Additionally, 1,1,7,7-Tetramethyljulolidine is often utilized in the synthesis of other chemical compounds and materials due to its ability to act as a building block in organic synthesis. Its CAS number, 325722-28-9, allows for easy identification in chemical databases and literature. Overall, this compound is significant in both academic research and industrial applications due to its distinctive properties and versatility.

Formula: C₁₆H₂₃N

InChI: InChI=1/C16H23N/c1-15(2)8-10-17-11-9-16(3,4)13-7-5-6-12(15)14(13)17/h5-7H,8-11H2,1-4H3

InChI key: MZKXTXKVGSAPEG-UHFFFAOYSA-N

SMILES: CC1(CCN2CCC(C3=CC=CC1=C32)(C)C)C

Synonyms:

• 1,1,7,7-tetramethyl-2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinoline
• 1,1,7,7-tetramethyl-2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij] quinoline