
CAS 325722-41-6
:1-(2,3-Difluorophenyl)-1,3-butanedione
Description:
1-(2,3-Difluorophenyl)-1,3-butanedione is an organic compound characterized by its unique structure, which includes a butanedione moiety substituted with a 2,3-difluorophenyl group. This compound typically exhibits properties associated with diketones, such as being a potential precursor in organic synthesis and exhibiting reactivity due to the presence of carbonyl groups. The difluorophenyl substituent can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of fluorine atoms can impart unique characteristics, such as increased lipophilicity and altered solubility in various solvents. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its specific applications and behavior in reactions would depend on the context of its use, including potential roles in drug development or as a building block in synthetic organic chemistry. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with reactive functional groups.
Formula:C10H8F2O2
InChI:InChI=1S/C10H8F2O2/c1-6(13)5-9(14)7-3-2-4-8(11)10(7)12/h2-4H,5H2,1H3
InChI key:InChIKey=URIREYUAPQQWAQ-UHFFFAOYSA-N
SMILES:C(CC(C)=O)(=O)C1=C(F)C(F)=CC=C1
Synonyms:- 1-(2,3-Difluorophenyl)-1,3-butanedione
- 1,3-Butanedione, 1-(2,3-difluorophenyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery