CAS 325724-70-7

5-Amino-2-chloro-N-(4-ethoxyphenyl)benzenesulfonamide

Description:

5-Amino-2-chloro-N-(4-ethoxyphenyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of an amino group and a chloro substituent on the benzene ring contributes to its reactivity and potential biological activity. The ethoxyphenyl moiety enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the sulfonamide group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. The compound's CAS number, 325724-70-7, allows for precise identification and retrieval of information in chemical databases. Safety data should be consulted for handling and storage, as sulfonamides can have specific toxicity profiles and may cause allergic reactions in sensitive individuals. Overall, this compound represents a class of molecules with significant interest in both research and therapeutic contexts.

Formula: C₁₄H₁₅ClN₂O₃S

InChI: InChI=1S/C14H15ClN2O3S/c1-2-20-12-6-4-11(5-7-12)17-21(18,19)14-9-10(16)3-8-13(14)15/h3-9,17H,2,16H2,1H3

InChI key: InChIKey=SBUJUALJFGVVIF-UHFFFAOYSA-N

SMILES: S(NC1=CC=C(OCC)C=C1)(=O)(=O)C2=C(Cl)C=CC(N)=C2

Synonyms:

• Benzenesulfonamide, 5-amino-2-chloro-N-(4-ethoxyphenyl)-
• 5-Amino-2-chloro-N-(4-ethoxyphenyl)benzenesulfonamide