CAS 325769-17-3

Pyridine, 4-[2-ethyl-4-(3-methylphenyl)-5-thiazolyl]-

Description:

Pyridine, 4-[2-ethyl-4-(3-methylphenyl)-5-thiazolyl]- is a heterocyclic organic compound characterized by a pyridine ring substituted with a thiazole moiety. The presence of the pyridine ring imparts basic properties, making it a weak base, while the thiazole group contributes to its potential reactivity and biological activity. This compound features an ethyl group and a 3-methylphenyl group, which enhance its lipophilicity and may influence its interactions in biological systems. The molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound may exhibit specific optical and electronic properties due to its conjugated system. Its CAS number, 325769-17-3, allows for precise identification in chemical databases, facilitating research and development efforts. Safety and handling considerations should be taken into account, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.

Formula: C₁₇H₁₆N₂S

InChI: InChI=1S/C17H16N2S/c1-3-15-19-16(14-6-4-5-12(2)11-14)17(20-15)13-7-9-18-10-8-13/h4-11H,3H2,1-2H3

InChI key: QUKIIQWKXMTFAE-UHFFFAOYSA-N

SMILES: CCC1=NC(=C(S1)C2=CC=NC=C2)C3=CC=CC(=C3)C