CAS 325773-40-8

3-(2-Bromoethyl)-6-chloro-1H-indole

Description:

3-(2-Bromoethyl)-6-chloro-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromoethyl group at the 3-position and a chloro substituent at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically used in research settings, particularly in studies related to pharmacology and organic synthesis. Its halogen substituents can enhance its biological activity and influence its interactions with biological targets. The compound's molecular structure suggests it may exhibit properties such as lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the presence of halogens often plays a role in the compound's stability and reactivity, making it a subject of interest for further investigation in drug development and chemical synthesis. As with any chemical, proper handling and safety measures should be observed due to potential hazards associated with halogenated compounds.

Formula: C₁₀H₉BrClN

InChI: InChI=1S/C10H9BrClN/c11-4-3-7-6-13-10-5-8(12)1-2-9(7)10/h1-2,5-6,13H,3-4H2

InChI key: InChIKey=MEUFXXHYUSBPSB-UHFFFAOYSA-N

SMILES: C(CBr)C=1C=2C(=CC(Cl)=CC2)NC1

Synonyms:

• 3-(2-Bromoethyl)-6-chloro-1H-indole
• 1H-Indole, 3-(2-bromoethyl)-6-chloro-
• 3-(2-Bromoethyl)-6-chloroindole