CymitQuimica logo

CAS 32580-41-9

:

1-(2-amino-5-nitrophenyl)ethanone

Description:
1-(2-amino-5-nitrophenyl)ethanone, also known by its CAS number 32580-41-9, is an organic compound characterized by the presence of an ethanone functional group attached to a substituted phenyl ring. This compound features an amino group and a nitro group on the aromatic ring, which significantly influence its chemical reactivity and properties. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the nitro group is known for its electron-withdrawing effects, which can enhance the electrophilicity of adjacent carbon atoms. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its unique structure makes it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a precursor for the synthesis of more complex molecules or as a potential pharmacophore in drug development. Safety precautions should be taken when handling this compound, as nitro-substituted compounds can be hazardous.
Formula:C8H8N2O3
InChI:InChI=1/C8H8N2O3/c1-5(11)7-4-6(10(12)13)2-3-8(7)9/h2-4H,9H2,1H3
InChI key:WYSBWHYLQMVOOL-UHFFFAOYSA-N
SMILES:CC(=O)c1cc(ccc1N)N(=O)=O
Synonyms:
  • 2'-Amino-5'-nitroacetophenone
  • 1-(2-amino-5-nitrophenyl)ethan-1-one
  • Ethanone, 1-(2-amino-5-nitrophenyl)-
  • (2-Acetyl-4-nitrophenyl)amine
  • 1-(2-amino-5-nitrophenyl)ethanone
Found 4 products.