CAS 325822-94-4

1-[2-(4-methoxyphenoxy)ethyl]-1H-benzimidazol-2-amine

Description:

1-[2-(4-methoxyphenoxy)ethyl]-1H-benzimidazol-2-amine, with the CAS number 325822-94-4, is a chemical compound characterized by its unique structural features, which include a benzimidazole core and a methoxyphenoxyethyl side chain. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the benzimidazole moiety often suggests possible applications in pharmaceuticals, particularly in areas such as anti-cancer or anti-inflammatory therapies, due to its ability to interact with biological targets. The methoxy group can enhance lipophilicity, potentially improving the compound's bioavailability. Additionally, the ether linkage in the side chain may influence solubility and stability. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest a promising profile for further investigation in medicinal chemistry and drug development. However, specific physical and chemical properties such as melting point, solubility, and reactivity would require empirical data for comprehensive analysis.

Formula: C₁₆H₁₇N₃O₂

InChI: InChI=1/C16H17N3O2/c1-20-12-6-8-13(9-7-12)21-11-10-19-15-5-3-2-4-14(15)18-16(19)17/h2-9H,10-11H2,1H3,(H2,17,18)

InChI key: SWTGVGMUAVYHSO-UHFFFAOYSA-N

SMILES: COc1ccc(cc1)OCCn1c2ccccc2[nH]c1=N

Synonyms:

• 1H-Benzimidazol-2-amine, 1-[2-(4-methoxyphenoxy)ethyl]-
• 1-[2-(4-Methoxyphenoxy)ethyl]-1H-benzimidazol-2-amine
• 1-[2-(4-methoxyphenoxy)ethyl]benzimidazol-2-amine
• TOSLAB 97867
• 1-[2-(4-METHOXY-PHENOXY)-ETHYL]-1H-BENZOIMIDAZOL-2-YLAMINE