CAS 3259-43-6
:4-(benzylsulfanyl)-6-fluorocinnoline
Description:
4-(Benzylsulfanyl)-6-fluorocinnoline is a chemical compound characterized by its unique structure, which includes a cinnoline core substituted with a benzylsulfanyl group and a fluorine atom. The presence of the benzylsulfanyl group introduces a sulfur atom into the molecule, which can influence its reactivity and solubility. The fluorine atom, known for its electronegativity, can enhance the compound's biological activity and lipophilicity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of both sulfur and fluorine can contribute to the compound's stability and interaction with biological systems. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility will depend on the specific conditions and the presence of other solvents or reagents. Overall, 4-(benzylsulfanyl)-6-fluorocinnoline represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C15H11FN2S
InChI:InChI=1/C15H11FN2S/c16-12-6-7-14-13(8-12)15(9-17-18-14)19-10-11-4-2-1-3-5-11/h1-9H,10H2
Synonyms:- Benzyl 6-fluoro-4-cinnolinyl sulfide
- 4-(Benzylthio)-6-fluorocinnoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
