CAS 325958-97-2

2-bromo-5-trimethylsilylpyridine;2-bromo-5-(trimethylsilyl)pyridine

Description:

2-Bromo-5-trimethylsilylpyridine, with the CAS number 325958-97-2, is a chemical compound characterized by its pyridine ring substituted with a bromine atom and a trimethylsilyl group. This compound typically exhibits a pale yellow to colorless appearance and is soluble in organic solvents such as dichloromethane and tetrahydrofuran, while being less soluble in water due to its hydrophobic trimethylsilyl group. The presence of the bromine atom introduces electrophilic reactivity, making it useful in various organic synthesis applications, particularly in nucleophilic substitution reactions. The trimethylsilyl group enhances the compound's stability and can serve as a protecting group for functional groups during chemical reactions. Additionally, 2-bromo-5-trimethylsilylpyridine can participate in cross-coupling reactions, making it valuable in the synthesis of more complex organic molecules. Its unique structural features and reactivity profile make it a significant compound in synthetic organic chemistry and materials science.

Formula: C₈H₁₂BrNSi

InChI: InChI=1S/C8H12BrNSi/c1-11(2,3)7-4-5-8(9)10-6-7/h4-6H,1-3H3

InChI key: RTWLWJUSMCRNHS-UHFFFAOYSA-N

SMILES: C[Si](C)(C)C1=CN=C(C=C1)Br