CAS 326-63-6

2-Fluorobenzeneacetamide

Description:

2-Fluorobenzeneacetamide, also known by its IUPAC name, is an aromatic amide characterized by the presence of a fluorine atom at the ortho position relative to the acetamide group on a benzene ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the fluorine atom can influence the compound's reactivity and polarity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. 2-Fluorobenzeneacetamide can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, due to the electrophilic nature of the carbonyl group in the amide. Its unique properties make it a valuable intermediate in organic synthesis and medicinal chemistry, where it may serve as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₈FNO

InChI: InChI=1S/C8H8FNO/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H2,10,11)

InChI key: InChIKey=DJSDMLCYBAQMCB-UHFFFAOYSA-N

SMILES: C(C(N)=O)C1=C(F)C=CC=C1

Synonyms:

• 2-Fluorobenzeneacetamide
• (2-Fluorophenyl)acetamide
• Benzeneacetamide, 2-fluoro-
• Acetamide, 2-(o-fluorophenyl)-
• (o-Fluorophenyl)acetamide

2-(2-Fluorophenyl)acetamide

CAS: 326-63-6

2-(2-Fluorophenyl)acetamide

Formula: C₈H₈FNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.15g/mol

Ref: 54-PC408273

2-(2-fluorophenyl)acetamide

CAS: 326-63-6

Formula: C₈H₈FNO

Purity: 95.0%

Molecular weight: 153.156

Ref: 10-F357591

2-(2-Fluorophenyl)acetamide

CAS: 326-63-6

2-(2-Fluorophenyl)acetamide is a nucleoside analogue that inhibits the activity of thymidine kinase, which is an enzyme that converts thymine to deoxyuridine monophosphate and vice versa. 2-(2-Fluorophenyl)acetamide has been shown to be effective against herpes simplex virus and is a lead compound for the development of antiviral compounds. This drug is not toxic to cells and has no adverse side effects.

Formula: C₈H₈FNO

Purity: Min. 95%

Molecular weight: 153.16 g/mol

Ref: 3D-AAA32663