CAS 3260-89-7

2-Chloro-6-methoxybenzoic acid

Description:

2-Chloro-6-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a chloro group and a methoxy group on a benzoic acid framework. Its molecular structure features a benzene ring substituted at the 2-position with a chlorine atom and at the 6-position with a methoxy group, along with a carboxylic acid functional group (-COOH). This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the chloro and methoxy substituents can influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, 2-Chloro-6-methoxybenzoic acid may serve as an intermediate in the synthesis of more complex organic compounds. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₈H₇ClO₃

InChI: InChI=1S/C8H7ClO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=JUOHBAJZQDTICO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC)C=CC=C1Cl

Synonyms:

• o-Anisic acid, 6-chloro-
• 2-Chloro-6-(methyloxy)benzoic acid
• Benzoic acid, 2-chloro-6-methoxy-
• 2-Chloro-6-methoxybenzoic acid

2-Chloro-6-methoxybenzoic acid

CAS: 3260-89-7

Formula: C₈H₇ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.5924

Ref: IN-DA00C6Z3

2-Chloro-6-methoxybenzoic acid

CAS: 3260-89-7

2-Chloro-6-methoxybenzoic acid

Purity: 97%

Molecular weight: 186.59g/mol

Ref: 54-OR321002

2-Chloro-6-methoxybenzoic acid

CAS: 3260-89-7

Formula: C₈H₇ClO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 186.59

Ref: 10-F076196