CAS 326023-00-1

4-Chloro-3-[[(3-chloro-4-methylphenyl)amino]sulfonyl]benzoic acid

Description:

4-Chloro-3-[[(3-chloro-4-methylphenyl)amino]sulfonyl]benzoic acid, identified by its CAS number 326023-00-1, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a sulfonamide group and multiple chloro and methyl substituents. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity may vary based on its structural features. The presence of chlorine atoms and a methyl group can influence its solubility, stability, and reactivity. In terms of physical properties, it may be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its functional groups. The sulfonamide group is known for its ability to form hydrogen bonds, which can affect its interaction with biological targets. Overall, this compound's unique combination of functional groups makes it of interest in various chemical and biological research fields.

Formula: C₁₄H₁₁Cl₂NO₄S

InChI: InChI=1S/C14H11Cl2NO4S/c1-8-2-4-10(7-12(8)16)17-22(20,21)13-6-9(14(18)19)3-5-11(13)15/h2-7,17H,1H3,(H,18,19)

InChI key: InChIKey=NVBDESMQYRNCMG-UHFFFAOYSA-N

SMILES: S(NC1=CC(Cl)=C(C)C=C1)(=O)(=O)C2=CC(C(O)=O)=CC=C2Cl

Synonyms:

• 4-Chloro-3-[[(3-chloro-4-methylphenyl)amino]sulfonyl]benzoic acid
• Benzoic acid, 4-chloro-3-[[(3-chloro-4-methylphenyl)amino]sulfonyl]-

4-Chloro-3-[(3-chloro-4-methylphenyl)sulfamoyl]benzoic acid

CAS: 326023-00-1

Versatile small molecule scaffold

Formula: C₁₄H₁₁Cl₂NO₄S

Purity: Min. 95%

Molecular weight: 360.2 g/mol

Ref: 3D-BNA02300