CAS 32607-23-1: Chloroanilic acid lanthanum salt

Description:Chloroanilic acid lanthanum salt, with the CAS number 32607-23-1, is a coordination compound formed from chloroanilic acid and lanthanum ions. This substance typically exhibits characteristics associated with both organic and inorganic compounds. Chloroanilic acid itself is an aromatic amine derivative, which contributes to the compound's potential solubility in polar solvents and its ability to form hydrogen bonds. The presence of lanthanum, a rare earth metal, imparts unique properties such as high thermal stability and potential catalytic activity. The compound may exhibit specific optical properties due to the lanthanum ion, which can influence its interaction with light. Additionally, lanthanum salts are often used in various applications, including catalysis, materials science, and as additives in certain chemical processes. The overall stability and reactivity of chloroanilic acid lanthanum salt can be influenced by factors such as pH, temperature, and the presence of other ions in solution. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula:C₁₈Cl₆La₂O₁₂

InChI:InChI=1S/C6H2Cl2O4.La/c7-1-3(9)5(11)2(8)6(12)4(1)10;/h9,12H;

InChI key:InChIKey=GGDTUKBVTAYUAN-UHFFFAOYSA-N

SMILES:[La].O=C1C(Cl)=C(O)C(=O)C(Cl)=C1O

Synonyms:
2,5-Cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy-, lanthanum(3+) salt (3:2)
Chloranilic acid lanthanum salt
Lanthanum 2,5-Dichloro-3,6-Dioxocyclohexa-1,4-Diene-1,4-Diolate (2:3)
Lanthanum chloranilate
Lanthanum, tris[chloranilato(2-)]di-
p-Benzoquinone, 2,5-dichloro-3,6-dihydroxy-, lanthanum(3+) salt (3:2)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
CHLORANILIC ACID LANTHANUM SALT REF: IN-DA003OS3CAS: 32607-23-1	98.0%	To inquire	Tue 29 Apr 25
Chloranilic Acid Lanthanum(III) Salt Decahydrate REF: 3B-C0079CAS: 32607-23-1	>98.0%(T)	45.00 €~133.00 €	Fri 02 May 25
Chloranilic Acid Lanthanum(III) Salt Decahydrate REF: 3D-HBA60723CAS: 32607-23-1	Min. 95%	- - -	Discontinued product