CAS 3261-05-0
:5-Chloro-benzofuran-3-one
Description:
5-Chloro-benzofuran-3-one is an organic compound characterized by its fused benzofuran structure, which consists of a benzene ring fused to a furan ring, with a chlorine substituent at the 5-position and a carbonyl group at the 3-position. This compound typically appears as a crystalline solid and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the chlorine atom can influence its reactivity and solubility, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. The carbonyl group contributes to its electrophilic character, allowing it to participate in various chemical reactions, such as nucleophilic additions. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential therapeutic uses. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or environmental impact.
Formula:C8H5ClO2
InChI:InChI=1/C8H5ClO2/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-3H,4H2
SMILES:c1cc2c(cc1Cl)C(=O)CO2
Synonyms:- 3(2H)-benzofuranone, 5-chloro-
- 5-Chlor-1-benzofuran-3(2H)-on
- 5-Chloro-1-benzofuran-3(2H)-one
- 5-Chlorocoumaran-3-one, 5-Chloro-2,3-dihydro-3-oxo-1-benzofuran, 5-Chloro-2,3-dihydro-3-oxobenzo[b]furan
- 5-CHLORO-BENZOFURAN-3-ONE
- 5-Chloro-3(2H)-benzofuranone
- 5-Bromo-3-Benzofuranone
- 5-chlorobenzofuran-3(2H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3(2H)-Benzofuranone, 5-chloro-
CAS:Formula:C8H5ClO2Purity:96%Color and Shape:SolidMolecular weight:168.57715-Chlorobenzo[b]furan-3(2H)-one
CAS:5-Chlorobenzo[b]furan-3(2H)-onePurity:96%Molecular weight:168.58g/mol5-Chloro-1-benzofuran-3(2H)-one
CAS:<p>5-Chloro-1-benzofuran-3(2H)-one (5CBF) is a versatile building block that can be used to make a wide range of different compounds. It has been shown as an effective reagent in the synthesis of complex compounds and research chemicals. 5CBF is also used as a high quality intermediate in organic synthesis, as well as being a useful scaffold for chemical reactions.</p>Formula:C8H5ClO2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:168.58 g/mol5-Chloro-benzofuran-3-one
CAS:Controlled ProductFormula:C8H5ClO2Color and Shape:NeatMolecular weight:168.577




